Systematic / IUPAC Name: 2,2'-[1,4-Phenylenebis(carbonylimino)]bis(3-phenylpropanoic acid)
ID: Reference6458
Other Names:
Formula: C26H24N2O6
2-[(4-{[(1-Carboxy-2-phenylethyl)amino]carbonyl}benzoyl)amino]-3-phenylpropanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2017 7:56:01 AM |
| InChI | InChI=1S/C26H24N2O6/c29-23(27-21(25(31)32)15-17-7-3-1-4-8-17)19-11-13-20(14-12-19)24(30)28-22(26(33)34)16-18-9-5-2-6-10-18/h1-14,21-22H,15-16H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
| InChI Key | MLSKRIBBXHNCJR-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC(=O)C2=CC=C(C=C2)C(=O)NC(CC3=CC=CC=C3)C(=O)O |
| CAS | |
| Splash | |
| Other Names |