Systematic / IUPAC Name: N-(1,3-Benzodioxol-5-ylmethyl)-6-phenylthieno[3,2-d]pyrimidin-4-amine
ID: Reference6465
Other Names:
N-(2H-1,3-Benzodioxol-5-ylmethyl)-6-phenylthieno[3,2-d]pyrimidin-4-amine;
Thieno[3,2-d]pyrimidin-4-amine, N-(1,3-benzodioxol-5-ylmethyl)-6-phenyl-
Formula: C20H15N3O2S
N-(1,3-Benzodioxol-5-ylmethyl)-6-phenylthieno[3,2-d]pyrimidin-4-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/13/2017 9:47:31 AM |
| InChI | InChI=1S/C20H15N3O2S/c1-2-4-14(5-3-1)18-9-15-19(26-18)20(23-11-22-15)21-10-13-6-7-16-17(8-13)25-12-24-16/h1-9,11H,10,12H2,(H,21,22,23) |
| InChI Key | XMFKHUJYYBHBPH-UHFFFAOYSA-N |
| Canonical SMILES | C1OC2=C(O1)C=C(C=C2)CNC3=NC=NC4=C3SC(=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
N-(2H-1,3-Benzodioxol-5-ylmethyl)-6-phenylthieno[3,2-d]pyrimidin-4-amine; Thieno[3,2-d]pyrimidin-4-amine, N-(1,3-benzodioxol-5-ylmethyl)-6-phenyl- |
| PubChem | 2809722 |
| ChemSpider | 2088143 |
| ChEMBL | CHEMBL205344 |