Systematic / IUPAC Name: 2-(4-Ethylsulfanyl-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine
ID: Reference6498
Other Names: 25T2-NBOMe
Formula: C20H27NO3S
Class: Drugs of Abuse/Illegal Drugs
2-[4-(Ethylsulfanyl)-2,5-dimethoxyphenyl]-N-(2-methoxybenzyl)ethanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/22/2022 7:54:05 AM |
| InChI | InChI=1S/C20H27NO3S.ClH/c1-5-25-20-13-18(23-3)15(12-19(20)24-4)10-11-21-14-16-8-6-7-9-17(16)22-2;/h6-9,12-13,21H,5,10-11,14H2,1-4H3;1H |
| InChI Key | OXWBOYFWLKCGEE-UHFFFAOYSA-N |
| Canonical SMILES | CCSC1=C(C=C(C(=C1)OC)CCNCC2=CC=CC=C2OC)OC.Cl |
| CAS | |
| Splash | |
| Other Names | 25T2-NBOMe |