Systematic / IUPAC Name: (17β)-17-Hydroxy-17-methylestra-4,9-dien-3-one
ID: Reference6501
            Other Names: 
                    (8S,13S,14S,17S)-17-Hydroxy-13,17-dimethyl-6,7,8,11,12,13,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3(2H)-one; 
                    17A-Methyl,17β-hydroxy-estra-4,9-diene-3-one; 
                    Methyl-D ; 
                    Methyl-Dien ; 
                    RU 3467 
        
Formula: C19H26O2
Class: Sports Doping Drugs Steroids/Vitamins/Hormones
Methyldienolone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap | 
| No. of Spectral Trees | 2 | 
| No. of Spectra | 227 | 
| Tandem Spectra | MS1, MS2 | 
| Ionization Methods | ESI | 
| Analyzers | FT | 
| Last Modification | 11/21/2018 1:23:29 PM | 
| InChI | InChI=1S/C19H26O2/c1-18-9-7-15-14-6-4-13(20)11-12(14)3-5-16(15)17(18)8-10-19(18,2)21/h11,16-17,21H,3-10H2,1-2H3/t16-,17+,18+,19+/m1/s1 | 
| InChI Key | RDJBOAMEIJEKEY-XWSJACJDSA-N | 
| Canonical SMILES | CC12CCC3=C4CCC(=O)C=C4CCC3C1CCC2(C)O | 
| CAS | 14531896 | 
| Splash | |
| Other Names | (8S,13S,14S,17S)-17-Hydroxy-13,17-dimethyl-6,7,8,11,12,13,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3(2H)-one; 17A-Methyl,17β-hydroxy-estra-4,9-diene-3-one; Methyl-D ; Methyl-Dien ; RU 3467 | 
| PubChem | 57495136 | 
| Wikipedia | Methyldienolone | 
| ChemSpider | 29364987 |