Systematic / IUPAC Name: 2'-Isopropenyl-5'-methyl-4-pentyl-2,6-biphenyldiol
ID: Reference6507
Other Names: 5'-Methyl-2'-(1-methylethenyl)-4-pentyl-[1,1'-biphenyl]-2,6-diol
Formula: C21H26O2
Class: Drugs of Abuse/Illegal Drugs
Cannabinodiol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 184 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/24/2017 7:59:24 AM |
| InChI | InChI=1S/C21H26O2/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3/h9-13,22-23H,2,5-8H2,1,3-4H3 |
| InChI Key | TWKHUZXSTKISQC-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCC1=CC(=C(C(=C1)O)C2=C(C=CC(=C2)C)C(=C)C)O |
| CAS | 39624812 |
| Splash | |
| Other Names | 5'-Methyl-2'-(1-methylethenyl)-4-pentyl-[1,1'-biphenyl]-2,6-diol |
| PubChem | 11551346 |
| Wikipedia | Cannabinodiol |
| ChemSpider | 9726124 |