Systematic / IUPAC Name: 1-[2-(Benzyloxy)phenyl]-2-(1H-imidazol-1-yl)-3-phenyl-2-propen-1-one
ID: Reference6530
Other Names: 2-Imidazol-1-yl-3-phenyl-1-(2-phenylmethoxyphenyl)prop-2-en-1-one
Formula: C25H20N2O2
1-[2-(Benzyloxy)phenyl]-2-(1H-imidazol-1-yl)-3-phenylprop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1589 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 4/3/2017 1:34:59 PM |
| InChI | InChI=1S/C25H20N2O2/c28-25(23(27-16-15-26-19-27)17-20-9-3-1-4-10-20)22-13-7-8-14-24(22)29-18-21-11-5-2-6-12-21/h1-17,19H,18H2 |
| InChI Key | OQMSGKDULKTGDY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2C(=O)C(=CC3=CC=CC=C3)N4C=CN=C4 |
| CAS | |
| Splash | |
| Other Names | 2-Imidazol-1-yl-3-phenyl-1-(2-phenylmethoxyphenyl)prop-2-en-1-one |