Systematic / IUPAC Name: Diethyl propanedioate
ID: Reference6583
            Other Names: 
                    1,3-Diethyl propanedioate; 
                    Carbethoxyacetic ester; 
                    Dicarbethoxymethane; 
                    Diethyl propane-1,3-dioate; 
                    Ethyl methanedicarboxylate
; more
        
Formula: C7H12O4
Class: Endogenous Metabolites Excipients/Additives/Colorants Personal Care Products/Cosmetics Industrial Chemicals
Diethyl malonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP | 
| No. of Spectral Trees | 1 | 
| No. of Spectra | 256 | 
| Tandem Spectra | MS1, MS2, MS3, MS4 | 
| Ionization Methods | NSI | 
| Analyzers | FT | 
| Last Modification | 4/24/2017 11:50:26 AM | 
| InChI | InChI=1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3 | 
| InChI Key | IYXGSMUGOJNHAZ-UHFFFAOYSA-N | 
| Canonical SMILES | CCOC(=O)CC(=O)OCC | 
| CAS | 105533 | 
| Splash | |
| Other Names | 1,3-Diethyl propanedioate; Carbethoxyacetic ester; Dicarbethoxymethane; Diethyl propane-1,3-dioate; Ethyl methanedicarboxylate; Ethyl propanedioate; Malonic acid, diethyl ester; Methanedicarboxylic acid, diethyl ester; Propanedioic acid, 1,3-diethyl ester; Propanedioic acid, diethyl ester | 
| PubChem | 7761 | 
| Wikipedia | Diethyl malonate | 
| HMDb | HMDB29573 | 
| ChemSpider | 13863636 | 
| ChEMBL | CHEMBL177114 |