Systematic / IUPAC Name: (2E)-11-Methyl-2-dodecenoic acid
ID: Reference6591
Other Names:
(E)-11-Methyldodec-2-enoic acid;
(2E)-11-Methyldodec-2-enoic acid;
trans-11-Methyl-2-dodecenoic acid;
trans-11-Methyldodec-2-enoic acid;
11-Methyl-2(E)-dodecenoic a;cid
Formula: C13H24O2
trans-Δ2-11-Methyl-dodecenoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 438 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/3/2017 6:15:59 AM |
| InChI | InChI=1S/C13H24O2/c1-12(2)10-8-6-4-3-5-7-9-11-13(14)15/h9,11-12H,3-8,10H2,1-2H3,(H,14,15)/b11-9+ |
| InChI Key | SNTXNGAQYNSTHI-PKNBQFBNSA-N |
| Canonical SMILES | CC(C)CCCCCCCC=CC(=O)O |
| CAS | 677354244 |
| Splash | |
| Other Names |
(E)-11-Methyldodec-2-enoic acid; (2E)-11-Methyldodec-2-enoic acid; trans-11-Methyl-2-dodecenoic acid; trans-11-Methyldodec-2-enoic acid; 11-Methyl-2(E)-dodecenoic a;cid |
| ChemSpider | 9610667 |
| PubChem | 11435803 |
| ChEBI | CHEBI:87153 |