Systematic / IUPAC Name: Ethyl hexadecanoate
ID: Reference6602
Other Names:
Ethyl n-hexadecanoate;
Ethyl cetylate;
Hexadecanoic acid ethyl ester;
Palmitic acid ethyl ester
Formula: C18H36O2
Ethyl palmitate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP ; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 437 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/12/2017 6:42:36 AM |
| InChI | InChI=1S/C18H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-4-2/h3-17H2,1-2H3 |
| InChI Key | XIRNKXNNONJFQO-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCCCCCC(=O)OCC |
| CAS | 628977 |
| Splash | |
| Other Names |
Ethyl n-hexadecanoate; Ethyl cetylate; Hexadecanoic acid ethyl ester; Palmitic acid ethyl ester |
| ChemIDPlus | 000628977 |
| ChemSpider | 11860 |
| ChEBI | CHEBI:84932 |
| HMDb | HMDB29811 |
| PubChem | 12366 |
| ChEMBL | CHEMBL3561042 |