Systematic / IUPAC Name: 1-({(E)-[1-(1H-Pyrrol-3-yl)ethylidene]amino}oxy)-1-hexanone
ID: Reference6625
Other Names: 1-Hexanone, 1-({[(1E)-1-(1H-pyrrol-3-yl)ethylidene]amino}oxy)-
Formula: C12H18N2O2
3-[(Hexanoyloxy)ethanimidoyl]-1H-pyrrole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 191 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/19/2017 11:12:39 AM |
| InChI | InChI=1S/C12H18N2O2/c1-3-4-5-6-12(15)16-14-10(2)11-7-8-13-9-11/h7-9,13H,3-6H2,1-2H3/b14-10+ |
| InChI Key | HTPXPMBGHZEXKU-GXDHUFHOSA-N |
| Canonical SMILES | CCCCCC(=O)O/N=C(\C)/c1cc[nH]c1 |
| CAS | |
| Splash | |
| Other Names | 1-Hexanone, 1-({[(1E)-1-(1H-pyrrol-3-yl)ethylidene]amino}oxy)- |
| ChemSpider | 17923174 |