Systematic / IUPAC Name: (4Z)-4-[(Dimethylamino)methylene]-2-[2-(4-methoxyphenoxy)-5-nitrophenyl]-1,3-oxazol-5(4H)-one
ID: Reference6632
Other Names:
Formula: C19H17N3O6
4-[(Dimethylamino)methylidene]-2-[2-(4-methoxyphenoxy)-5-nitrophenyl]-4,5-dihydro-1,3-oxazol-5-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/20/2017 1:55:45 PM |
| InChI | InChI=1S/C19H17N3O6/c1-21(2)11-16-19(23)28-18(20-16)15-10-12(22(24)25)4-9-17(15)27-14-7-5-13(26-3)6-8-14/h4-11H,1-3H3/b16-11- |
| InChI Key | YTEVNYSQVFBPFH-WJDWOHSUSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |