Systematic / IUPAC Name: Methyl (2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate
ID: Reference672
Other Names:
Thieno(3,2-c)pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (S)-;
(S)-Methyl 2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate;
Methyl (2S)-2-(2-chlorophenyl)-2-{4H,5H,6H,7H-thieno[3,2-c]pyridin-5-yl}acetate;
Plavix;
(S)-Clopidogrel
Formula: C16H16ClNO2S
Class: Therapeutics/Prescription Drugs
Clopidogrel mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 99 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/19/2015 11:54:02 AM |
| InChI | InChI=1S/C16H16ClNO2S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14/h2-5,7,9,15H,6,8,10H2,1H3/t15-/m0/s1 |
| InChI Key | GKTWGGQPFAXNFI-HNNXBMFYSA-N |
| Canonical SMILES | COC(=O)C(C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3 |
| CAS | 113665842 |
| Splash | |
| Other Names |
Thieno(3,2-c)pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (S)-; (S)-Methyl 2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate; Methyl (2S)-2-(2-chlorophenyl)-2-{4H,5H,6H,7H-thieno[3,2-c]pyridin-5-yl}acetate; Plavix; (S)-Clopidogrel |
| DrugBank | APRD00444 |
| ChemIDPlus | 113665842 |
| ChEMBL | CHEMBL1771 |
| KEGG | D07729 |
| PubChem | 60606 |
| Wikipedia | Clopidogrel |
| ChemSpider | 54632 |
| HMDb | HMDB05011 |
| ChEBI | CHEBI:37941 |