Systematic / IUPAC Name: 1-(4-Bromophenyl)-2-[(5-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]ethanone
ID: Reference6735
Other Names: Ethanone, 1-(4-bromophenyl)-2-[(5-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)thio]-
Formula: C19H13BrN4OS
1-(4-Bromophenyl)-2-[(5-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]-1-ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2017 1:00:05 PM |
| InChI | InChI=1S/C19H13BrN4OS/c20-15-8-6-14(7-9-15)17(25)11-26-18-10-16(13-4-2-1-3-5-13)23-19-21-12-22-24(18)19/h1-10,12H,11H2 |
| InChI Key | ZMAOGYLRNDBRTC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NC3=NC=NN3C(=C2)SCC(=O)C4=CC=C(C=C4)Br |
| CAS | |
| Splash | |
| Other Names | Ethanone, 1-(4-bromophenyl)-2-[(5-phenyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)thio]- |