Systematic / IUPAC Name: Ethyl 3-(benzoyloxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate
ID: Reference675
Other Names:
Ethylcocaine;
Ethyl benzoylecgonine;
Cocaethyline;
Benzoylethylecgonin;
Ecgonine ethyl ester benzoate
; more
Formula: C18H23NO4
Class: Drugs of Abuse/Illegal Drugs
Cocaethylene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/19/2015 12:39:59 PM |
| InChI | InChI=1S/C18H23NO4/c1-3-22-18(21)16-14-10-9-13(19(14)2)11-15(16)23-17(20)12-7-5-4-6-8-12/h4-8,13-16H,3,9-11H2,1-2H3/t13-,14+,15-,16+/m0/s1 |
| InChI Key | NMPOSNRHZIWLLL-XUWVNRHRSA-N |
| Canonical SMILES | CCOC(=O)C1C2CCC(N2C)CC1OC(=O)C3=CC=CC=C3 |
| CAS | 529384 |
| Splash | |
| Other Names |
Ethylcocaine; Ethyl benzoylecgonine; Cocaethyline; Benzoylethylecgonin; Ecgonine ethyl ester benzoate; Cocaethylin; O-Benzoyl-L-ecgonine ethyl ester; 8-Azabicyclo[3.2.1]octane-2-carboxylic acid, 3-(benzoyloxy)-8-methyl-, ethyl ester, [1R-(exo,exo)]-; [1R-(Exo,exo)]-3-(benzoyloxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid ethyl ester; Homococaine; Homocaine |
| Wikipedia | Cocaethylene |
| PubChem | 644006 |
| ChemSpider | 59082 |