Systematic / IUPAC Name: 3-(Benzylsulfanyl)-4-methyl-5-[(2-thienylsulfanyl)methyl]-4H-1,2,4-triazole
ID: Reference6759
Other Names: 4H-1,2,4-Triazole, 4-methyl-3-[(phenylmethyl)thio]-5-[(2-thienylthio)methyl]-
Formula: C15H15N3S3
3-(Benzylthio)-4-methyl-5-[(2-thienylthio)methyl]-4H-1,2,4-triazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/28/2017 8:55:37 AM |
| InChI | InChI=1S/C15H15N3S3/c1-18-13(11-20-14-8-5-9-19-14)16-17-15(18)21-10-12-6-3-2-4-7-12/h2-9H,10-11H2,1H3 |
| InChI Key | RRRGBWJQGJNXRM-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=NN=C1SCC2=CC=CC=C2)CSC3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names | 4H-1,2,4-Triazole, 4-methyl-3-[(phenylmethyl)thio]-5-[(2-thienylthio)methyl]- |