Systematic / IUPAC Name: 6-Azidohexanoic acid
ID: Reference6768
Other Names:
6-Azidohexanoicacid;
Hexanoic acid, 6-azido-
Formula: C6H11N3O2
6-Azidohexanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 3 |
| No. of Spectra | 299 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/28/2017 8:06:04 AM |
| InChI | InChI=1S/C6H11N3O2/c7-9-8-5-3-1-2-4-6(10)11/h1-5H2,(H,10,11) |
| InChI Key | JCORXJUUSVCJEP-UHFFFAOYSA-N |
| Canonical SMILES | C(CCC(=O)O)CCN=[N+]=[N-] |
| CAS | 79598531 |
| Splash | |
| Other Names |
6-Azidohexanoicacid; Hexanoic acid, 6-azido- |