Systematic / IUPAC Name: 4,6-Bis(4-chlorophenyl)-1,3,5-triazin-2(5H)-one
ID: Reference6795
Other Names: 1,3,5-Triazin-2(1H)-one,4,6-bis(4-chlorophenyl)-
Formula: C15H9Cl2N3O
4,6-Bis(4-chlorophenyl)-1,3,5-triazin-2-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/8/2017 12:05:11 PM |
| InChI | InChI=1S/C15H9Cl2N3O/c16-11-5-1-9(2-6-11)13-18-14(20-15(21)19-13)10-3-7-12(17)8-4-10/h1-8H,(H,18,19,20,21) |
| InChI Key | IOOPJAOQXWQJLY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C2=NC(=O)N=C(N2)C3=CC=C(C=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 1,3,5-Triazin-2(1H)-one,4,6-bis(4-chlorophenyl)- |