Systematic / IUPAC Name: N'-(4-Chlorobenzoyl)-2-(2-thienyl)-1,3-thiazole-4-carbohydrazide
ID: Reference6846
Other Names: 4-Thiazolecarboxylic acid, 2-(2-thienyl)-, 2-(4-chlorobenzoyl)hydrazide
Formula: C15H10ClN3O2S2
N'4-(4-Chlorobenzoyl)-2-(2-thienyl)-1,3-thiazole-4-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/20/2017 12:05:29 PM |
| InChI | InChI=1S/C15H10ClN3O2S2/c16-10-5-3-9(4-6-10)13(20)18-19-14(21)11-8-23-15(17-11)12-2-1-7-22-12/h1-8H,(H,18,20)(H,19,21) |
| InChI Key | ULSMZGGENQYXHL-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)C2=NC(=CS2)C(=O)NNC(=O)C3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | 4-Thiazolecarboxylic acid, 2-(2-thienyl)-, 2-(4-chlorobenzoyl)hydrazide |
| PubChem | 2743956 |
| ChEBI | CHEBI:93020 |
| ChEMBL | CHEMBL1865706 |
| ChemSpider | 2025459 |