Systematic / IUPAC Name: 5-Chloro-1-ethyl-1,3-dihydro-2H-benzimidazole-2-thione
ID: Reference6853
Other Names: 2H-Benzimidazole-2-thione, 5-chloro-1-ethyl-1,3-dihydro-
Formula: C9H9ClN2S
5-Chloro-1-ethyl-1H-benzimidazole-2-thiol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/22/2017 6:48:14 AM |
| InChI | InChI=1S/C9H9ClN2S/c1-2-12-8-4-3-6(10)5-7(8)11-9(12)13/h3-5H,2H2,1H3,(H,11,13) |
| InChI Key | OPMZGSYBJXINHP-UHFFFAOYSA-N |
| Canonical SMILES | CCN1C2=C(C=C(C=C2)Cl)NC1=S |
| CAS | |
| Splash | |
| Other Names | 2H-Benzimidazole-2-thione, 5-chloro-1-ethyl-1,3-dihydro- |
| ChemSpider | 2025739 |
| ChEMBL | CHEMBL1540189 |
| PubChem | 2744238 |