Systematic / IUPAC Name: 5-{2-Ethoxy-5-[(4-methyl-1-piperazinyl)carbonyl]phenyl}-1-methyl-3-propyl-1,4-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one
ID: Reference686
Other Names:
Formula: C23H30N6O3
Class: Counterfeit Drug (Therapeutic) Illegal Additives
Desmethyl carbodenafil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 75 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/23/2015 10:02:33 AM |
| InChI | InChI=1S/C23H30N6O3/c1-5-7-17-19-20(28(4)26-17)22(30)25-21(24-19)16-14-15(8-9-18(16)32-6-2)23(31)29-12-10-27(3)11-13-29/h8-9,14H,5-7,10-13H2,1-4H3,(H,24,25,30) |
| InChI Key | RIFGMSHSTNMHMS-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |