Systematic / IUPAC Name: [1-(5-Chloropentyl)-1H-indazol-3-yl](1-naphthyl)methanone
ID: Reference6885
Other Names:
Methanone, [1-(5-chloropentyl)-1H-indazol-3-yl]-1-naphthalenyl-;
5-Chloropentyl JWH 018 indazole analog ;
THJ 018 chloro analog
Formula: C23H21ClN2O
5-Chloro THJ 018 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/4/2017 6:34:52 AM |
| InChI | InChI=1S/C23H21ClN2O/c24-15-6-1-7-16-26-21-14-5-4-12-20(21)22(25-26)23(27)19-13-8-10-17-9-2-3-11-18(17)19/h2-5,8-14H,1,6-7,15-16H2 |
| InChI Key | KLRDJQQYGMTILS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=NN(C4=CC=CC=C43)CCCCCCl |
| CAS | |
| Splash | |
| Other Names |
Methanone, [1-(5-chloropentyl)-1H-indazol-3-yl]-1-naphthalenyl-; 5-Chloropentyl JWH 018 indazole analog ; THJ 018 chloro analog |