Systematic / IUPAC Name:
ID: Reference6894
Other Names:
Formula: C17H25NO
3',4'-Dimethyl-α-pyrrolidinovalerophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/21/2022 1:56:39 PM |
| InChI | InChI=1S/C17H25NO/c1-4-7-16(18-10-5-6-11-18)17(19)15-9-8-13(2)14(3)12-15/h8-9,12,16H,4-7,10-11H2,1-3H3 |
| InChI Key | IKKXRCRMSQZNLG-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |