Systematic / IUPAC Name: Methyl (E)-α-(methoxyimino)-2-((2-methylphenoxy)methyl)benzeneacetate
ID: Reference69
Other Names:
Benzeneacetic acid, α-(methoxyimino)-2-((2-methylphenoxy)methyl)-, methyl ester, (E)-;
(E)-Methyl 2-(methoxyimino)-2-(2-((o-tolyloxy)methyl)phenyl)acetate;
Methyl (2E)-2-methoxyimino-2-[2-[(2-methylphenoxy)methyl]phenyl]ethanoate;
(2E)-2-Methoxyimino-2-[2-[(2-methylphenoxy)methyl]phenyl]acetic acid methyl ester;
Bas 490F
Formula: C18H19NO4
Class: Pesticides/Herbicides
Kresoxim methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4740 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/15/2015 12:59:47 PM |
| InChI | InChI=1S/C18H19NO4/c1-13-8-4-7-11-16(13)23-12-14-9-5-6-10-15(14)17(19-22-3)18(20)21-2/h4-11H,12H2,1-3H3/b19-17+ |
| InChI Key | ZOTBXTZVPHCKPN-HTXNQAPBSA-N |
| Canonical SMILES | O=C(OC)/C(=N\OC)c1c(cccc1)COc2ccccc2C |
| CAS | 143390890 |
| Splash | |
| Other Names |
Benzeneacetic acid, α-(methoxyimino)-2-((2-methylphenoxy)methyl)-, methyl ester, (E)-; (E)-Methyl 2-(methoxyimino)-2-(2-((o-tolyloxy)methyl)phenyl)acetate; Methyl (2E)-2-methoxyimino-2-[2-[(2-methylphenoxy)methyl]phenyl]ethanoate; (2E)-2-Methoxyimino-2-[2-[(2-methylphenoxy)methyl]phenyl]acetic acid methyl ester; Bas 490F |
| ChEMBL | CHEMBL203191 |
| ChemIDPlus | 143390890 |
| ChemSpider | 4588320 |
| PubChem | 5483874; 86438; 6112114 |
| Wikipedia | Kresoxim-methyl (DE) |
| KEGG | C11017 |