Systematic / IUPAC Name: Dibutyl (2E)-2-butenedioate
ID: Reference690
Other Names:
Maleic acid, dibutyl ester;
2-Butenedioic acid (Z)-, dibutyl ester;
Maleic acid dibutyl ester;
Staflex DBM
Formula: C12H20O4
Class: Endogenous Metabolites
Dibutyl maleate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/23/2015 12:21:01 PM |
| InChI | InChI=1S/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7- |
| InChI Key | JBSLOWBPDRZSMB-FPLPWBNLSA-N |
| Canonical SMILES | |
| CAS | 105760 |
| Splash | |
| Other Names |
Maleic acid, dibutyl ester; 2-Butenedioic acid (Z)-, dibutyl ester; Maleic acid dibutyl ester; Staflex DBM |
| PubChem | 5271569 |
| ChEMBL | CHEMBL1466826 |
| ChemIDPlus | 062851734 |
| ChemSpider | 4436356 |