Systematic / IUPAC Name: 5-Methyl-1-(1,3,5-trimethylpyrazol-4-yl)triazole
ID: Reference6921
Other Names: 1H-1,2,3-Triazole, 5-methyl-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)-
Formula: C9H13N5
5-Methyl-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)-1H-1,2,3-triazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2017 7:21:31 AM |
| InChI | InChI=1S/C9H13N5/c1-6-5-10-12-14(6)9-7(2)11-13(4)8(9)3/h5H,1-4H3 |
| InChI Key | HMYPRNRPYXKLOU-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CN=NN1C2=C(N(N=C2C)C)C |
| CAS | |
| Splash | |
| Other Names | 1H-1,2,3-Triazole, 5-methyl-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)- |