Systematic / IUPAC Name: Bis(4-acetylphenyl) methanedisulfonate
ID: Reference6923
Other Names: Methanedisulfonic acid, bis(4-acetylphenyl) ester
Formula: C17H16O8S2
Bis(4-acetylphenyl) methanedisulfonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2017 7:28:59 AM |
| InChI | InChI=1S/C17H16O8S2/c1-12(18)14-3-7-16(8-4-14)24-26(20,21)11-27(22,23)25-17-9-5-15(6-10-17)13(2)19/h3-10H,11H2,1-2H3 |
| InChI Key | VXRNREOYAATZGC-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)OS(=O)(=O)CS(=O)(=O)OC2=CC=C(C=C2)C(=O)C |
| CAS | |
| Splash | |
| Other Names | Methanedisulfonic acid, bis(4-acetylphenyl) ester |