Systematic / IUPAC Name: 1-[2-(2-Chlorophenyl)-5-(3-pyridinyl)-1,3,4-oxadiazol-3(2H)-yl]ethanone
ID: Reference6932
Other Names: Ethanone, 1-[2-(2-chlorophenyl)-5-(3-pyridinyl)-1,3,4-oxadiazol-3(2H)-yl]-
Formula: C15H12ClN3O2
1-[2-(2-Chlorophenyl)-5-(3-pyridyl)-2,3-dihydro-1,3,4-oxadiazol-3-yl]ethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 91 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2017 11:56:58 AM |
| InChI | InChI=1S/C15H12ClN3O2/c1-10(20)19-15(12-6-2-3-7-13(12)16)21-14(18-19)11-5-4-8-17-9-11/h2-9,15H,1H3 |
| InChI Key | AHZPLNVIFLTGLU-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)N1C(OC(=N1)C2=CN=CC=C2)C3=CC=CC=C3Cl |
| CAS | |
| Splash | |
| Other Names | Ethanone, 1-[2-(2-chlorophenyl)-5-(3-pyridinyl)-1,3,4-oxadiazol-3(2H)-yl]- |
| ChEMBL | CHEMBL1459206 |
| PubChem | 2796437 |
| ChemSpider | 2075298 |