Systematic / IUPAC Name: Dimethyl benzene-1,3-dicarboxylate
ID: Reference696
Other Names:
Isophthalic acid dimethyl ester;
Methyl 3-(carbomethoxy)benzoate;
Dimethyl 1,3-benzenedicarboxylate;
1,3-Benzenedicarboxylic acid dimethyl ester;
Methyl 3-(methoxycarbonyl)benzoate
; more
Formula: C10H10O4
Class: Industrial Chemicals
Dimethyl isophthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/23/2015 4:24:55 PM |
| InChI | InChI=1S/C10H10O4/c1-13-9(11)7-4-3-5-8(6-7)10(12)14-2/h3-6H,1-2H3 |
| InChI Key | VNGOYPQMJFJDLV-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=CC(=CC=C1)C(=O)OC |
| CAS | 1459934 |
| Splash | |
| Other Names |
Isophthalic acid dimethyl ester; Methyl 3-(carbomethoxy)benzoate; Dimethyl 1,3-benzenedicarboxylate; 1,3-Benzenedicarboxylic acid dimethyl ester; Methyl 3-(methoxycarbonyl)benzoate; 1,3-Dimethyl benzene-1,3-dicarboxylate; Benzene-1,3-dicarboxylic acid dimethyl ester |
| Wikipedia | Dimethyl phthalate |
| ChemSpider | 14360 |
| ChEMBL | CHEMBL2010300 |
| PubChem | 15088 |
| ChemIDPlus | 001459934 |