Systematic / IUPAC Name: Dimethyl benzene-1,4-dicarboxylate
ID: Reference698
Other Names:
Dimethyl p-phthalate;
Dimethyl p-benzenedicarboxylate;
Dimethyl 1,4-benzenedicarboxylate;
Methyl 4-carbomethoxybenzoate;
Terephthalic acid dimethyl ester
; more
Formula: C10H10O4
Class: Industrial Chemicals Extractables/Leachables
Dimethyl terephthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/12/2016 7:59:07 AM |
| InChI | InChI=1S/C10H10O4/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2/h3-6H,1-2H3 |
| InChI Key | WOZVHXUHUFLZGK-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=CC=C(C=C1)C(=O)OC |
| CAS | 120616 |
| Splash | |
| Other Names |
Dimethyl p-phthalate; Dimethyl p-benzenedicarboxylate; Dimethyl 1,4-benzenedicarboxylate; Methyl 4-carbomethoxybenzoate; Terephthalic acid dimethyl ester; Methyl p-(methoxycarbonyl)benzoate; Methyl 4-(methoxycarbonyl)benzoate; 1,4-Dimethylbenzene-1,4-dicarboxylate; Benzene-1,4-dicarboxylic acid dimethyl ester; Dimethyl ester of 1,4-benzenedicarboxylic acid |
| ChEMBL | CHEMBL1870757 |
| ChemSpider | 13863300 |
| PubChem | 8441 |
| Wikipedia | Dimethyl terephthalate |