Systematic / IUPAC Name: 1-(10H-Phenothiazin-10-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]sulfanyl}ethanone
ID: Reference7008
Other Names: Ethanone, 1-(10H-phenothiazin-10-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio}-
Formula: C27H19N5OS2
1-(10H-Phenothiazin-10-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-1-ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 8:35:01 AM |
| InChI | InChI=1S/C27H19N5OS2/c33-25(32-21-10-4-6-12-23(21)35-24-13-7-5-11-22(24)32)18-34-27-30-29-26(19-14-16-28-17-15-19)31(27)20-8-2-1-3-9-20/h1-17H,18H2 |
| InChI Key | IYYMBWXNENQWAH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)N2C(=NN=C2SCC(=O)N3C4=CC=CC=C4SC5=CC=CC=C53)C6=CC=NC=C6 |
| CAS | |
| Splash | |
| Other Names | Ethanone, 1-(10H-phenothiazin-10-yl)-2-{[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio}- |