Systematic / IUPAC Name: Diphenylphosphinic acid
ID: Reference701
Other Names:
Phosphinic acid, diphenyl-;
Hydroxydiphenylphosphine oxide
Formula: C12H11O2P
Diphenylphosphinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2015 10:48:54 AM |
| InChI | InChI=1S/C12H11O2P/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,13,14) |
| InChI Key | BEQVQKJCLJBTKZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)O |
| CAS | 1707035 |
| Splash | |
| Other Names |
Phosphinic acid, diphenyl-; Hydroxydiphenylphosphine oxide |
| ChEBI | CHEBI:37832 |
| ChemIDPlus | 001707035 |
| ChemSpider | 14810 |
| PubChem | 15567 |