Systematic / IUPAC Name: Ethyl 3-methyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylate
ID: Reference7014
Other Names: 5H-Thiazolo[3,2-a]pyrimidine-2-carboxylic acid, 6,7-dihydro-3-methyl-, ethyl ester
Formula: C10H14N2O2S
Ethyl 3-methyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 8:52:14 AM |
| InChI | InChI=1S/C10H14N2O2S/c1-3-14-9(13)8-7(2)12-6-4-5-11-10(12)15-8/h3-6H2,1-2H3 |
| InChI Key | NTVHZTUWMAMRSQ-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(N2CCCN=C2S1)C |
| CAS | |
| Splash | |
| Other Names | 5H-Thiazolo[3,2-a]pyrimidine-2-carboxylic acid, 6,7-dihydro-3-methyl-, ethyl ester |