Systematic / IUPAC Name: Oxo(diphenyl)phosphanium
ID: Reference702
Other Names:
Phosphine oxide, diphenyl-;
Diphenylphosphane oxide;
Diphenylphosphino-1-one
Formula: C12H11OP
Diphenylphosphine oxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/24/2015 1:37:22 PM |
| InChI | InChI=1S/C12H10OP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/q+1 |
| InChI Key | YFPJFKYCVYXDJK-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 4559700 |
| Splash | |
| Other Names |
Phosphine oxide, diphenyl-; Diphenylphosphane oxide; Diphenylphosphino-1-one |