Systematic / IUPAC Name: 4-Amino-1-{5-O-[bis(4-methoxyphenyl)(phenyl)methyl]-2-deoxypentofuranosyl}-2(1H)-pyrimidinone
ID: Reference7025
Other Names: 2(1H)-Pyrimidinone, 4-amino-1-{5-O-[bis(4-methoxyphenyl)phenylmethyl]-2-deoxypentofuranosyl}-
Formula: C30H31N3O6
4-Amino-1-(5-{[bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-4-hydroxytetrahydrofuran-2-yl)pyrimidin-2(1H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 9:32:29 AM |
| InChI | InChI=1S/C30H31N3O6/c1-36-23-12-8-21(9-13-23)30(20-6-4-3-5-7-20,22-10-14-24(37-2)15-11-22)38-19-26-25(34)18-28(39-26)33-17-16-27(31)32-29(33)35/h3-17,25-26,28,34H,18-19H2,1-2H3,(H2,31,32,35) |
| InChI Key | XMBLVFBRAADPJF-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=CC(=NC5=O)N)O |
| CAS | |
| Splash | |
| Other Names | 2(1H)-Pyrimidinone, 4-amino-1-{5-O-[bis(4-methoxyphenyl)phenylmethyl]-2-deoxypentofuranosyl}- |