Systematic / IUPAC Name: 1-(3,4-Dimethylthieno[2,3-b]thiophen-2-yl)-3,3-bis(methylsulfanyl)-2-propen-1-one
ID: Reference7040
Other Names: 2-Propen-1-one, 1-(3,4-dimethylthieno[2,3-b]thien-2-yl)-3,3-bis(methylthio)-
Formula: C13H14OS4
1-(3,4-Dimethylthieno[2,3-b]thiophen-2-yl)-3,3-bis(methylthio)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2017 12:37:36 PM |
| InChI | InChI=1S/C13H14OS4/c1-7-6-17-13-11(7)8(2)12(18-13)9(14)5-10(15-3)16-4/h5-6H,1-4H3 |
| InChI Key | VIFRAQAYRDAJCR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CSC2=C1C(=C(S2)C(=O)C=C(SC)SC)C |
| CAS | |
| Splash | |
| Other Names | 2-Propen-1-one, 1-(3,4-dimethylthieno[2,3-b]thien-2-yl)-3,3-bis(methylthio)- |