Systematic / IUPAC Name: 2-(2,5-Dimethylbenzyl)-1,6,8-trimethyl-1,6-dihydrodipyrazolo[3,4-b:3',4'-d]pyridin-3(2H)-one
ID: Reference7066
Other Names: Dipyrazolo[3,4-b:3',4'-d]pyridin-3(2H)-one, 2-[(2,5-dimethylphenyl)methyl]-1,6-dihydro-1,6,8-trimethyl-
Formula: C19H21N5O
2-(2,5-Dimethylbenzyl)-1,6,8-trimethyl-1,2,3,6-tetrahydrodipyrazolo[3,4-b:3,4-d]pyridin-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/22/2018 7:08:00 AM |
| InChI | InChI=1S/C19H21N5O/c1-11-6-7-12(2)14(8-11)10-24-19(25)15-9-20-18-16(17(15)23(24)5)13(3)21-22(18)4/h6-9H,10H2,1-5H3 |
| InChI Key | YCRGRAWSUYJKHE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C=C1)C)CN2C(=O)C3=CN=C4C(=C3N2C)C(=NN4C)C |
| CAS | |
| Splash | |
| Other Names | Dipyrazolo[3,4-b:3',4'-d]pyridin-3(2H)-one, 2-[(2,5-dimethylphenyl)methyl]-1,6-dihydro-1,6,8-trimethyl- |