Systematic / IUPAC Name: 7-Hydroxy-4-({[5-(methylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl}methyl)-2H-chromen-2-one
ID: Reference7082
Other Names: 2H-1-Benzopyran-2-one, 7-hydroxy-4-({[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}methyl)-
Formula: C13H10N2O3S3
7-Hydroxy-4-({[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}methyl)-2H-chromen-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/24/2017 2:21:40 PM |
| InChI | InChI=1S/C13H10N2O3S3/c1-19-12-14-15-13(21-12)20-6-7-4-11(17)18-10-5-8(16)2-3-9(7)10/h2-5,16H,6H2,1H3 |
| InChI Key | HVKLBRGQHLBKOK-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=NN=C(S1)SCC2=CC(=O)OC3=C2C=CC(=C3)O |
| CAS | |
| Splash | |
| Other Names | 2H-1-Benzopyran-2-one, 7-hydroxy-4-({[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}methyl)- |