Systematic / IUPAC Name: 4-(5-Chloro-3-methyl-1-benzothiophen-2-yl)-2-(4-chlorophenyl)-1,3-thiazole
ID: Reference7088
Other Names: Thiazole, 4-(5-chloro-3-methylbenzo[b]thien-2-yl)-2-(4-chlorophenyl)-
Formula: C18H11Cl2NS2
4-(5-Chloro-3-methylbenzo[b]thiophen-2-yl)-2-(4-chlorophenyl)-1,3-thiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/27/2017 11:27:42 AM |
| InChI | InChI=1S/C18H11Cl2NS2/c1-10-14-8-13(20)6-7-16(14)23-17(10)15-9-22-18(21-15)11-2-4-12(19)5-3-11/h2-9H,1H3 |
| InChI Key | NWXBWGLFCQEUSD-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC2=C1C=C(C=C2)Cl)C3=CSC(=N3)C4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | Thiazole, 4-(5-chloro-3-methylbenzo[b]thien-2-yl)-2-(4-chlorophenyl)- |