Systematic / IUPAC Name: Methyl 3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate
ID: Reference709
Other Names:
Methyl ecgonine;
Ecgonine methyl ester;
8-Azabicyclo(3.2.1)octane-2-carboxylic acid, 3-hydroxy-8-methyl-, methyl ester, (1R,2R,3S,5S)-;
Methyl (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;
(1R,2R,3S,5S)-2-(Methoxycarbonyl)tropan-3-ol
Formula: C10H17NO3
Class: Drugs of Abuse/Illegal Drugs
Ecgonine methyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 129 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/25/2015 1:50:44 PM |
| InChI | InChI=1S/C10H17NO3/c1-11-6-3-4-7(11)9(8(12)5-6)10(13)14-2/h6-9,12H,3-5H2,1-2H3/t6-,7+,8-,9+/m0/s1 |
| InChI Key | QIQNNBXHAYSQRY-UYXSQOIJSA-N |
| Canonical SMILES | CN1C2CCC1C(C(C2)O)C(=O)OC |
| CAS | 7143091 |
| Splash | |
| Other Names |
Methyl ecgonine; Ecgonine methyl ester; 8-Azabicyclo(3.2.1)octane-2-carboxylic acid, 3-hydroxy-8-methyl-, methyl ester, (1R,2R,3S,5S)-; Methyl (1R,2R,3S,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate; (1R,2R,3S,5S)-2-(Methoxycarbonyl)tropan-3-ol; 3-Hydroxy-8-methyl-8-aza-bicyclo[3.2.1]octane-2-carboxylic acid methyl ester |
| ChEBI | CHEBI:31529 |
| ChemIDPlus | 007143091 |
| ChemSpider | 94674 |
| ChEMBL | CHEMBL1232472 |
| PubChem | 104904 |