Systematic / IUPAC Name: 2-(Adamantan-1-yl)-5H-thieno[3',2':5,6]thiopyrano[4,3-d]pyrimidine
ID: Reference7117
Other Names: 5H-Thieno[3',2':5,6]thiopyrano[4,3-d]pyrimidine, 2-tricyclo[3.3.1.13,7]dec-1-yl-
Formula: C19H20N2S2
2-(1-Adamantyl)-5H-thieno[3',2':5,6]thiino[4,3-d]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2017 9:12:20 AM |
| InChI | InChI=1S/C19H20N2S2/c1-2-22-17-15(1)16-14(10-23-17)9-20-18(21-16)19-6-11-3-12(7-19)5-13(4-11)8-19/h1-2,9,11-13H,3-8,10H2 |
| InChI Key | IWHWJQUBASUAHX-UHFFFAOYSA-N |
| Canonical SMILES | C1C2CC3CC1CC(C2)(C3)C4=NC=C5CSC6=C(C5=N4)C=CS6 |
| CAS | |
| Splash | |
| Other Names | 5H-Thieno[3',2':5,6]thiopyrano[4,3-d]pyrimidine, 2-tricyclo[3.3.1.13,7]dec-1-yl- |