Systematic / IUPAC Name: 1-(2-Deoxy-5-O-phosphonopentofuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione
ID: Reference712
Other Names:
DTMP;
Deoxythymidylate;
5-Thymidylic acid;
Deoxy TMP;
Deoxythymidine phosphate
; more
Formula: C10H15N2O8P
Class: Endogenous Metabolites
Thymidine 5'-monophosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 370 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/26/2015 10:37:26 AM |
| InChI | InChI=1S/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/t6-,7+,8+/m0/s1 |
| InChI Key | GYOZYWVXFNDGLU-XLPZGREQSA-N |
| Canonical SMILES | O=P(O)(O)OCC2OC(N\1C(=O)NC(=O)/C(=C/1)C)CC2O |
| CAS | 365071 |
| Splash | |
| Other Names |
DTMP; Deoxythymidylate; 5-Thymidylic acid; Deoxy TMP; Deoxythymidine phosphate; Thymidine mononucleotide; Thymidine phosphate |
| KEGG | C00364 |
| Wikipedia | Thymidine monophosphate |
| ChemSpider | 9319 |
| ChemIDPlus | 000365071; 025086811; 075652492; 024939091; 086834222; 002642435 |
| ChEBI | CHEBI:17013 |
| DrugBank | 9700 |
| PubChem | 9700 |
| HMDb | HMDB01227 |
| ChEMBL | CHEMBL394429 |