Systematic / IUPAC Name: 2-(2-Hydroxyethyl)-2,3-dihydro-1,4-phthalazinedione
ID: Reference7124
Other Names: 1,4-Phthalazinedione, 2,3-dihydro-2-(2-hydroxyethyl)-
Formula: C10H10N2O3
4-Hydroxy-2-(2-hydroxyethyl)-1,2-dihydrophthalazin-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 207 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2017 8:02:40 AM |
| InChI | InChI=1S/C10H10N2O3/c13-6-5-12-10(15)8-4-2-1-3-7(8)9(14)11-12/h1-4,13H,5-6H2,(H,11,14) |
| InChI Key | VSHRODYGAFXQBB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)NN(C2=O)CCO |
| CAS | |
| Splash | |
| Other Names | 1,4-Phthalazinedione, 2,3-dihydro-2-(2-hydroxyethyl)- |