Systematic / IUPAC Name: 2-(4-Methylphenyl)-4-phenyl-2,3-dihydro-1,5-benzothiazepine
ID: Reference7137
Other Names:
Formula: C22H19NS
2-(4-Methylphenyl)-4-phenyl-2,3-dihydro-1,5-benzothiazepine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/6/2017 11:36:43 AM |
| InChI | InChI=1S/C22H19NS/c1-16-11-13-18(14-12-16)22-15-20(17-7-3-2-4-8-17)23-19-9-5-6-10-21(19)24-22/h2-14,22H,15H2,1H3 |
| InChI Key | BDUFIUKJOJCAHE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C2CC(=NC3=CC=CC=C3S2)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 2010650 |
| PubChem | 2728660 |
| ChEMBL | CHEMBL2237291 |