Systematic / IUPAC Name: {(4E,6E)-12-{[3,6-Dideoxy-3-(dimethylamino)hexopyranosyl]oxy}-11-[2-(3,5-dimethyl-1-piperidinyl)ethyl]-2-ethyl-14-hydroxy-5,9,13-trimethyl-8,16-dioxooxacyclohexadeca-4,6-dien-3-yl}methyl 6-deoxy-2,3-di-O-methylhexopyranoside
ID: Reference714
Other Names: Micotil
Formula: C46H80N2O13
Class: Therapeutics/Prescription Drugs
Tilmicosin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 333 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/26/2015 2:41:30 PM |
| InChI | InChI=1S/C46H80N2O13/c1-13-36-33(24-57-46-44(56-12)43(55-11)40(53)31(8)59-46)19-25(2)14-15-34(49)28(5)20-32(16-17-48-22-26(3)18-27(4)23-48)42(29(6)35(50)21-37(51)60-36)61-45-41(54)38(47(9)10)39(52)30(7)58-45/h14-15,19,26-33,35-36,38-46,50,52-54H,13,16-18,20-24H2,1-12H3/b15-14+,25-19+/t26-,27+,28-,29+,30-,31-,32+,33-,35-,36-,38+,39-,40-,41-,42-,43-,44-,45+,46-/m1/s1 |
| InChI Key | JTSDBFGMPLKDCD-XVFHVFLVSA-N |
| Canonical SMILES | CCC1C(/C=C(/C=C/C(=O)C(CC(C(C(C(CC(=O)O1)O)C)OC2C(C(C(C(O2)C)O)N(C)C)O)CCN3CC(CC(C3)C)C)C)\C)COC4C(C(C(C(O4)C)O)OC)OC |
| CAS | 108050540 |
| Splash | |
| Other Names | Micotil |
| PubChem | 5282521 |
| ChemSpider | 4445656 |
| ChEMBL | CHEMBL1908333 |
| Wikipedia | Tilmicosin |
| KEGG | D02492 |