Systematic / IUPAC Name: 5-Chloro-6-methyl-2-(2-pyridinyl)-4(1H)-pyrimidinethione
ID: Reference7153
Other Names:
5-Chloro-6-methyl-2-(2-pyridyl)-1H-pyrimidine-4-thione;
4(1H)-Pyrimidinethione, 5-chloro-6-methyl-2-(2-pyridinyl)-
Formula: C10H8ClN3S
5-Chloro-6-methyl-2-(2-pyridyl)pyrimidine-4-thiol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/8/2017 10:29:15 AM |
| InChI | InChI=1S/C10H8ClN3S/c1-6-8(11)10(15)14-9(13-6)7-4-2-3-5-12-7/h2-5H,1H3,(H,13,14,15) |
| InChI Key | OMVHUYAQBLWYAA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=S)N=C(N1)C2=CC=CC=N2)Cl |
| CAS | |
| Splash | |
| Other Names |
5-Chloro-6-methyl-2-(2-pyridyl)-1H-pyrimidine-4-thione; 4(1H)-Pyrimidinethione, 5-chloro-6-methyl-2-(2-pyridinyl)- |
| ChemSpider | 2008026 |
| PubChem | 2725954 |
| ChEMBL | CHEMBL1539016 |