Systematic / IUPAC Name: 3-(2-Methyl-1-piperidinyl)propyl benzoate
ID: Reference7164
Other Names:
Metycaine;
Neothesin;
γ-(2-Methylpiperidyl)propyl benzoate;
(2-Methylpiperidino)propyl benzoate;
2-Methyl-1-piperidinepropanol, benzoate
; more
Formula: C16H23NO2
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
Piperocaine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/12/2017 1:24:11 PM |
| InChI | InChI=1S/C16H23NO2/c1-14-8-5-6-11-17(14)12-7-13-19-16(18)15-9-3-2-4-10-15/h2-4,9-10,14H,5-8,11-13H2,1H3 |
| InChI Key | YQKAVWCGQQXBGW-UHFFFAOYSA-N |
| Canonical SMILES | CC1CCCCN1CCCOC(=O)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
Metycaine; Neothesin; γ-(2-Methylpiperidyl)propyl benzoate; (2-Methylpiperidino)propyl benzoate; 2-Methyl-1-piperidinepropanol, benzoate; 3-(2-Methyl-1-piperidyl)propyl benzoate; 3-(2-Methylpiperidin-1-yl)propyl benzoate; 3-(2-Methylpiperidino)propyl benzoate; 3-Benzoxy-1-(2-methylpiperidino)propane; Benzoyl-γ-(2-methylpiperidino)propanol; Isocaine base |
| ChEBI | CHEBI:34925 |
| ChemIDPlus | 000136823; 032248376 |
| ChEMBL | CHEMBL127865 |
| PubChem | 10782 |
| Wikipedia | Piperocaine |
| ChemSpider | 10326 |
| KEGG | C14173 |