Systematic / IUPAC Name: 17,20,21-Trihydroxypregna-1,4-diene-3,11-dione
ID: Reference7173
Other Names: Pregna-1,4-diene-3,11-dione, 17,20,21-trihydroxy-
Formula: C21H28O5
Class: Therapeutics/Prescription Drugs
20β-Dihydroprednisone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 286 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/12/2017 1:20:29 PM |
| InChI | InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-15,17-18,22,25-26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,17?,18+,19-,20-,21-/m0/s1 |
| InChI Key | UMAIDVARGWSZLM-BNHZJTPYSA-N |
| Canonical SMILES | CC12CC(=O)C3C(C1CCC2(C(CO)O)O)CCC4=CC(=O)C=CC34C |
| CAS | |
| Splash | |
| Other Names | Pregna-1,4-diene-3,11-dione, 17,20,21-trihydroxy- |