Systematic / IUPAC Name: 4-Allyl-1,2-diphenyl-3,5-pyrazolidinedione
ID: Reference7202
Other Names:
3,5-Pyrazolidinedione, 1,2-diphenyl-4-(2-propenyl)-;
3,5-Pyrazolidinedione, 4-allyl-1,2-diphenyl-;
4-Allyl-1,2-diphenyl-3,5-dioxopyrazolidine
Formula: C18H16N2O2
4-Allyl-1,2-diphenyl-3,5-pyrazolidinedione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 213 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/20/2017 8:52:24 AM |
| InChI | InChI=1S/C18H16N2O2/c1-2-9-16-17(21)19(14-10-5-3-6-11-14)20(18(16)22)15-12-7-4-8-13-15/h2-8,10-13,16H,1,9H2 |
| InChI Key | FCNPWXFVAPWQQO-UHFFFAOYSA-N |
| Canonical SMILES | C=CCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
3,5-Pyrazolidinedione, 1,2-diphenyl-4-(2-propenyl)-; 3,5-Pyrazolidinedione, 4-allyl-1,2-diphenyl-; 4-Allyl-1,2-diphenyl-3,5-dioxopyrazolidine |