Systematic / IUPAC Name: Diphenyl carbonate
ID: Reference7274
Other Names:
Phenol carbonate;
Carbonic acid, diphenyl ester;
Phenyl carbonate;
Phenyl phenoxyformate
Formula: C13H10O3
Class: Extractables/Leachables
Diphenyl carbonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1124 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 9:45:19 AM |
| InChI | InChI=1S/C13H10O3/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H |
| InChI Key | ROORDVPLFPIABK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| CAS | 102090 |
| Splash | |
| Other Names |
Phenol carbonate; Carbonic acid, diphenyl ester; Phenyl carbonate; Phenyl phenoxyformate |
| KEGG | C14507 |
| Wikipedia | Diphenyl_carbonate |
| ChEBI | CHEBI:34722 |
| ChEMBL | CHEMBL3188080 |
| ChemIDPlus | 000102090; 029862100; 087836984; 073003551; 103694753 |
| ChemSpider | 7315 |
| PubChem | 7597 |