Systematic / IUPAC Name: Oxiran-2-ylmethyl 2-methylprop-2-enoate
ID: Reference7279
Other Names:
Acriester G;
(Oxiran-2-yl)methyl 2-methylprop-2-enoate;
1-Propanol, 2,3-epoxy-, methacrylate;
2-[(Methacryloxy)methyl]oxirane ;
2,3-Epoxypropanol methacrylate
; more
Formula: C7H10O3
Class: Extractables/Leachables
Glycidyl methacrylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/28/2018 9:46:53 AM |
| InChI | InChI=1S/C7H10O3/c1-5(2)7(8)10-4-6-3-9-6/h6H,1,3-4H2,2H3 |
| InChI Key | VOZRXNHHFUQHIL-UHFFFAOYSA-N |
| Canonical SMILES | CC(=C)C(=O)OCC1CO1 |
| CAS | 106912 |
| Splash | |
| Other Names |
Acriester G; (Oxiran-2-yl)methyl 2-methylprop-2-enoate; 1-Propanol, 2,3-epoxy-, methacrylate; 2-[(Methacryloxy)methyl]oxirane ; 2,3-Epoxypropanol methacrylate; 2,3-Epoxypropyl methacrylate; 2,3-Epoxypropyl methacrylic acid ester; 2-Methyl-acrylic acid oxiranylmethyl ester; 2-Oxiranylmethyl 2-methylacrylate; 2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester; 2-Propenoic acid, 2-methyl-, oxiranylmethyl ester; Glycidol methacrylate; Glycidyl α-methylacrylate; Methacrylic acid 2,3-epoxypropyl ester; Methacrylic acid glycidyl ester; Methacrylic acid, 2,3-epoxypropyl ester; Oxiran-2-ylmethyl 2-methylacrylate; Oxiran-2-ylmethyl methacrylate |
| ChEBI | CHEBI:132844 |
| ChEMBL | CHEMBL1333073 |
| ChemIDPlus | 000106912; 025067054; 026660377; 041259374 |
| Wikipedia | Glycidyl_methacrylate |
| ChemSpider | 7549 |
| PubChem | 7837 |